C18H20N2O3 — CID 153303687
2-methyl-8-(4,4,5,5-tetramethyl-1,3,2-dioxazolidin-2-yl)-[1]benzofuro[2,3-b]pyridine (PubChem CID 153303687) has the molecular formula C18H20N2O3 and a molecular weight of 312.37 g/mol. Its IUPAC name is 2-methyl-8-(4,4,5,5-tetramethyl-1,3,2-dioxazolidin-2-yl)-[1]benzofuro[2,3-b]pyridine.
| Compound Name | 2-methyl-8-(4,4,5,5-tetramethyl-1,3,2-dioxazolidin-2-yl)-[1]benzofuro[2,3-b]pyridine |
|---|---|
| PubChem CID | 153303687 |
| Molecular Formula | C18H20N2O3 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | 2-methyl-8-(4,4,5,5-tetramethyl-1,3,2-dioxazolidin-2-yl)-[1]benzofuro[2,3-b]pyridine |
| SMILES | Cc1ccc2c(n1)oc1c(N3OC(C)(C)C(C)(C)O3)cccc12 |
| InChI | InChI=1S/C18H20N2O3/c1-11-9-10-13-12-7-6-8-14(15(12)21-16(13)19-11)20-22-17(2,3)18(4,5)23-20/h6-10H,1-5H3 |
| InChIKey | BWNUCPBFBHJCQF-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 47.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |