C17H13N3O — CID 176956277
2-methyl-8-pyridin-2-yl-[1]benzofuro[2,3-b]pyridin-7-amine (PubChem CID 176956277) has the molecular formula C17H13N3O and a molecular weight of 275.31 g/mol. Its IUPAC name is 2-methyl-8-pyridin-2-yl-[1]benzofuro[2,3-b]pyridin-7-amine.
| Compound Name | 2-methyl-8-pyridin-2-yl-[1]benzofuro[2,3-b]pyridin-7-amine |
|---|---|
| PubChem CID | 176956277 |
| Molecular Formula | C17H13N3O |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | 2-methyl-8-pyridin-2-yl-[1]benzofuro[2,3-b]pyridin-7-amine |
| SMILES | Cc1ccc2c(n1)oc1c(-c3ccccn3)c(N)ccc12 |
| InChI | InChI=1S/C17H13N3O/c1-10-5-6-12-11-7-8-13(18)15(14-4-2-3-9-19-14)16(11)21-17(12)20-10/h2-9H,18H2,1H3 |
| InChIKey | YXMWSBDVWBIXTD-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|