C31H23N4O+ — CID 140861474
2,7-dimethyl-8-(10-methyl-3,6-diaza-10-azoniapentacyclo[6.6.6.02,7.09,14.015,20]icosa-2,4,6,9(14),10,12,15,17,19-nonaen-11-yl)-[1]benzofuro[2,3-b]pyridine (PubChem CID 140861474) has the molecular formula C31H23N4O+ and a molecular weight of 467.55 g/mol. Its IUPAC name is 2,7-dimethyl-8-(10-methyl-3,6-diaza-10-azoniapentacyclo[6.6.6.02,7.09,14.015,20]icosa-2,4,6,9(14),10,12,15,17,19-nonaen-11-yl)-[1]benzofuro[2,3-b]pyridine.
| Compound Name | 2,7-dimethyl-8-(10-methyl-3,6-diaza-10-azoniapentacyclo[6.6.6.02,7.09,14.015,20]icosa-2,4,6,9(14),10,12,15,17,19-nonaen-11-yl)-[1]benzofuro[2,3-b]pyridine |
|---|---|
| PubChem CID | 140861474 |
| Molecular Formula | C31H23N4O+ |
| Molecular Weight | 467.55 g/mol |
| Exact Mass | 467.19 |
| IUPAC Name | 2,7-dimethyl-8-(10-methyl-3,6-diaza-10-azoniapentacyclo[6.6.6.02,7.09,14.015,20]icosa-2,4,6,9(14),10,12,15,17,19-nonaen-11-yl)-[1]benzofuro[2,3-b]pyridine |
| SMILES | Cc1ccc2c(n1)oc1c(-c3ccc4c([n+]3C)C3c5ccccc5C4c4nccnc43)c(C)ccc12 |
| InChI | InChI=1S/C31H23N4O/c1-16-8-10-20-21-11-9-17(2)34-31(21)36-30(20)24(16)23-13-12-22-25-18-6-4-5-7-19(18)26(29(22)35(23)3)28-27(25)32-14-15-33-28/h4-15,25-26H,1-3H3/q+1 |
| InChIKey | RQAZJKDXBHDWDN-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 55.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.55 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|