C27H25N2O+ — CID 158814787
8-[3-[2,6-bis(trideuteriomethyl)phenyl]-1-methylpyridin-1-ium-2-yl]-2,7-dimethyl-[1]benzofuro[2,3-b]pyridine (PubChem CID 158814787) has the molecular formula C27H25N2O+ and a molecular weight of 399.55 g/mol. Its IUPAC name is 8-[3-[2,6-bis(trideuteriomethyl)phenyl]-1-methylpyridin-1-ium-2-yl]-2,7-dimethyl-[1]benzofuro[2,3-b]pyridine.
| Compound Name | 8-[3-[2,6-bis(trideuteriomethyl)phenyl]-1-methylpyridin-1-ium-2-yl]-2,7-dimethyl-[1]benzofuro[2,3-b]pyridine |
|---|---|
| PubChem CID | 158814787 |
| Molecular Formula | C27H25N2O+ |
| Molecular Weight | 399.55 g/mol |
| Exact Mass | 399.23 |
| IUPAC Name | 8-[3-[2,6-bis(trideuteriomethyl)phenyl]-1-methylpyridin-1-ium-2-yl]-2,7-dimethyl-[1]benzofuro[2,3-b]pyridine |
| SMILES | [2H]C([2H])([2H])c1cccc(C([2H])([2H])[2H])c1-c1ccc[n+](C)c1-c1c(C)ccc2c1oc1nc(C)ccc12 |
| InChI | InChI=1S/C27H25N2O/c1-16-8-6-9-17(2)23(16)22-10-7-15-29(5)25(22)24-18(3)11-13-20-21-14-12-19(4)28-27(21)30-26(20)24/h6-15H,1-5H3/q+1/i1D3,2D3 |
| InChIKey | FREALNLRBHYPNL-WFGJKAKNSA-N |
| XLogP | 6.37 |
| TPSA | 29.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.55 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|