C30H29N2O+ — CID 123588042
8-[3-(4-cyclopentylphenyl)-1-methylpyridin-1-ium-2-yl]-2,7-dimethyl-[1]benzofuro[2,3-b]pyridine (PubChem CID 123588042) has the molecular formula C30H29N2O+ and a molecular weight of 433.58 g/mol. Its IUPAC name is 8-[3-(4-cyclopentylphenyl)-1-methylpyridin-1-ium-2-yl]-2,7-dimethyl-[1]benzofuro[2,3-b]pyridine.
| Compound Name | 8-[3-(4-cyclopentylphenyl)-1-methylpyridin-1-ium-2-yl]-2,7-dimethyl-[1]benzofuro[2,3-b]pyridine |
|---|---|
| PubChem CID | 123588042 |
| Molecular Formula | C30H29N2O+ |
| Molecular Weight | 433.58 g/mol |
| Exact Mass | 433.23 |
| IUPAC Name | 8-[3-(4-cyclopentylphenyl)-1-methylpyridin-1-ium-2-yl]-2,7-dimethyl-[1]benzofuro[2,3-b]pyridine |
| SMILES | Cc1ccc2c(n1)oc1c(-c3c(-c4ccc(C5CCCC5)cc4)ccc[n+]3C)c(C)ccc12 |
| InChI | InChI=1S/C30H29N2O/c1-19-10-16-25-26-17-11-20(2)31-30(26)33-29(25)27(19)28-24(9-6-18-32(28)3)23-14-12-22(13-15-23)21-7-4-5-8-21/h6,9-18,21H,4-5,7-8H2,1-3H3/q+1 |
| InChIKey | MGHSRMDSTPIDNI-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 29.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.58 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|