C25H23N2O+ — CID 157080211
4-[1,4-dimethyl-5-(trideuteriomethyl)pyridin-1-ium-2-yl]-3,7-dimethyl-[1]benzofuro[2,3-b]quinoline (PubChem CID 157080211) has the molecular formula C25H23N2O+ and a molecular weight of 370.49 g/mol. Its IUPAC name is 4-[1,4-dimethyl-5-(trideuteriomethyl)pyridin-1-ium-2-yl]-3,7-dimethyl-[1]benzofuro[2,3-b]quinoline.
| Compound Name | 4-[1,4-dimethyl-5-(trideuteriomethyl)pyridin-1-ium-2-yl]-3,7-dimethyl-[1]benzofuro[2,3-b]quinoline |
|---|---|
| PubChem CID | 157080211 |
| Molecular Formula | C25H23N2O+ |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | 4-[1,4-dimethyl-5-(trideuteriomethyl)pyridin-1-ium-2-yl]-3,7-dimethyl-[1]benzofuro[2,3-b]quinoline |
| SMILES | [2H]C([2H])([2H])c1c[n+](C)c(-c2c(C)ccc3c2oc2nc4c(C)cccc4cc23)cc1C |
| InChI | InChI=1S/C25H23N2O/c1-14-9-10-19-20-12-18-8-6-7-15(2)23(18)26-25(20)28-24(19)22(14)21-11-16(3)17(4)13-27(21)5/h6-13H,1-5H3/q+1/i4D3 |
| InChIKey | SRMNCBHDYRJEPP-GKOSEXJESA-N |
| XLogP | 5.86 |
| TPSA | 29.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|