C41H33N2O+ — CID 140861492
8-[4-(6,11-dimethyl-4-pentacyclo[6.6.6.02,7.09,14.015,20]icosa-2(7),3,5,9(14),10,12,15,17,19-nonaenyl)-1-methylpyridin-1-ium-2-yl]-2,7-dimethyl-[1]benzofuro[2,3-b]pyridine (PubChem CID 140861492) has the molecular formula C41H33N2O+ and a molecular weight of 569.73 g/mol. Its IUPAC name is 8-[4-(6,11-dimethyl-4-pentacyclo[6.6.6.02,7.09,14.015,20]icosa-2(7),3,5,9(14),10,12,15,17,19-nonaenyl)-1-methylpyridin-1-ium-2-yl]-2,7-dimethyl-[1]benzofuro[2,3-b]pyridine.
| Compound Name | 8-[4-(6,11-dimethyl-4-pentacyclo[6.6.6.02,7.09,14.015,20]icosa-2(7),3,5,9(14),10,12,15,17,19-nonaenyl)-1-methylpyridin-1-ium-2-yl]-2,7-dimethyl-[1]benzofuro[2,3-b]pyridine |
|---|---|
| PubChem CID | 140861492 |
| Molecular Formula | C41H33N2O+ |
| Molecular Weight | 569.73 g/mol |
| Exact Mass | 569.26 |
| IUPAC Name | 8-[4-(6,11-dimethyl-4-pentacyclo[6.6.6.02,7.09,14.015,20]icosa-2(7),3,5,9(14),10,12,15,17,19-nonaenyl)-1-methylpyridin-1-ium-2-yl]-2,7-dimethyl-[1]benzofuro[2,3-b]pyridine |
| SMILES | Cc1ccc2c(c1)C1c3ccccc3C2c2cc(-c3cc[n+](C)c(-c4c(C)ccc5c4oc4nc(C)ccc45)c3)cc(C)c21 |
| InChI | InChI=1S/C41H33N2O/c1-22-10-13-30-33(18-22)39-29-9-7-6-8-28(29)38(30)34-20-27(19-24(3)36(34)39)26-16-17-43(5)35(21-26)37-23(2)11-14-31-32-15-12-25(4)42-41(32)44-40(31)37/h6-21,38-39H,1-5H3/q+1 |
| InChIKey | JPQPCZCYZDGUDJ-UHFFFAOYSA-N |
| XLogP | 9.36 |
| TPSA | 29.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.73 |
| LogP ≤ 5 | 9.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|