C20H16N3O2+ — CID 140827950
5,13-dimethyl-14-(1-methylpyrazin-1-ium-2-yl)-8,16-dioxa-6-azatetracyclo[7.7.0.02,7.010,15]hexadeca-1(9),2(7),3,5,10(15),11,13-heptaene (PubChem CID 140827950) has the molecular formula C20H16N3O2+ and a molecular weight of 330.37 g/mol. Its IUPAC name is 5,13-dimethyl-14-(1-methylpyrazin-1-ium-2-yl)-8,16-dioxa-6-azatetracyclo[7.7.0.02,7.010,15]hexadeca-1(9),2(7),3,5,10(15),11,13-heptaene.
| Compound Name | 5,13-dimethyl-14-(1-methylpyrazin-1-ium-2-yl)-8,16-dioxa-6-azatetracyclo[7.7.0.02,7.010,15]hexadeca-1(9),2(7),3,5,10(15),11,13-heptaene |
|---|---|
| PubChem CID | 140827950 |
| Molecular Formula | C20H16N3O2+ |
| Molecular Weight | 330.37 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | 5,13-dimethyl-14-(1-methylpyrazin-1-ium-2-yl)-8,16-dioxa-6-azatetracyclo[7.7.0.02,7.010,15]hexadeca-1(9),2(7),3,5,10(15),11,13-heptaene |
| SMILES | Cc1ccc2c(n1)oc1c3ccc(C)c(-c4cncc[n+]4C)c3oc21 |
| InChI | InChI=1S/C20H16N3O2/c1-11-4-6-13-17(16(11)15-10-21-8-9-23(15)3)24-19-14-7-5-12(2)22-20(14)25-18(13)19/h4-10H,1-3H3/q+1 |
| InChIKey | HRHYPWFGOLYCEQ-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 55.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.37 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|