About 8-pyridin-2-yl-2,5-bis(trideuteriomethyl)-[1]benzofuro[2,3-b]pyridine
8-pyridin-2-yl-2,5-bis(trideuteriomethyl)-[1]benzofuro[2,3-b]pyridine (PubChem CID 122419767) has the molecular formula C18H14N2O
and a molecular weight of 280.36 g/mol. Its IUPAC name is 8-pyridin-2-yl-2,5-bis(trideuteriomethyl)-[1]benzofuro[2,3-b]pyridine.
Molecular Properties
| Compound Name | 8-pyridin-2-yl-2,5-bis(trideuteriomethyl)-[1]benzofuro[2,3-b]pyridine |
| PubChem CID | 122419767 |
| Molecular Formula | C18H14N2O |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | 8-pyridin-2-yl-2,5-bis(trideuteriomethyl)-[1]benzofuro[2,3-b]pyridine |
| SMILES | [2H]C([2H])([2H])c1ccc2c(n1)oc1c(-c3ccccn3)ccc(C([2H])([2H])[2H])c12 |
| InChI | InChI=1S/C18H14N2O/c1-11-6-8-13(15-5-3-4-10-19-15)17-16(11)14-9-7-12(2)20-18(14)21-17/h3-10H,1-2H3/i1D3,2D3 |
| InChIKey | NXJJUYJDNXSOPE-WFGJKAKNSA-N |
| XLogP | 4.66 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-pyridin-2-yl-2,5-bis(trideuteriomethyl)-[1]benzofuro[2,3-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-pyridin-2-yl-2,5-bis(trideuteriomethyl)-[1]benzofuro[2,3-b]pyridine?
The IUPAC name of 8-pyridin-2-yl-2,5-bis(trideuteriomethyl)-[1]benzofuro[2,3-b]pyridine (CID 122419767) is 8-pyridin-2-yl-2,5-bis(trideuteriomethyl)-[1]benzofuro[2,3-b]pyridine.
What is the SMILES notation for 8-pyridin-2-yl-2,5-bis(trideuteriomethyl)-[1]benzofuro[2,3-b]pyridine?
The canonical SMILES for 8-pyridin-2-yl-2,5-bis(trideuteriomethyl)-[1]benzofuro[2,3-b]pyridine is [2H]C([2H])([2H])c1ccc2c(n1)oc1c(-c3ccccn3)ccc(C([2H])([2H])[2H])c12.
What is the InChIKey of 8-pyridin-2-yl-2,5-bis(trideuteriomethyl)-[1]benzofuro[2,3-b]pyridine?
The InChIKey is NXJJUYJDNXSOPE-WFGJKAKNSA-N. The full InChI is InChI=1S/C18H14N2O/c1-11-6-8-13(15-5-3-4-10-19-15)17-16(11)14-9-7-12(2)20-18(14)21-17/h3-10H,1-2H3/i1D3,2D3.
What are the key properties of 8-pyridin-2-yl-2,5-bis(trideuteriomethyl)-[1]benzofuro[2,3-b]pyridine?
8-pyridin-2-yl-2,5-bis(trideuteriomethyl)-[1]benzofuro[2,3-b]pyridine has a molecular weight of 280.36 g/mol, XLogP of 4.66, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-pyridin-2-yl-2,5-bis(trideuteriomethyl)-[1]benzofuro[2,3-b]pyridine is sourced from PubChem (CID 122419767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).