C24H13F5N2O — CID 90138452
2,7-dimethyl-8-[4-(2,3,4,5,6-pentafluorophenyl)-2-pyridinyl]-[1]benzofuro[2,3-b]pyridine (PubChem CID 90138452) has the molecular formula C24H13F5N2O and a molecular weight of 440.37 g/mol. Its IUPAC name is 2,7-dimethyl-8-[4-(2,3,4,5,6-pentafluorophenyl)-2-pyridinyl]-[1]benzofuro[2,3-b]pyridine.
| Compound Name | 2,7-dimethyl-8-[4-(2,3,4,5,6-pentafluorophenyl)-2-pyridinyl]-[1]benzofuro[2,3-b]pyridine |
|---|---|
| PubChem CID | 90138452 |
| Molecular Formula | C24H13F5N2O |
| Molecular Weight | 440.37 g/mol |
| Exact Mass | 440.09 |
| IUPAC Name | 2,7-dimethyl-8-[4-(2,3,4,5,6-pentafluorophenyl)-2-pyridinyl]-[1]benzofuro[2,3-b]pyridine |
| SMILES | Cc1ccc2c(n1)oc1c(-c3cc(-c4c(F)c(F)c(F)c(F)c4F)ccn3)c(C)ccc12 |
| InChI | InChI=1S/C24H13F5N2O/c1-10-3-5-13-14-6-4-11(2)31-24(14)32-23(13)16(10)15-9-12(7-8-30-15)17-18(25)20(27)22(29)21(28)19(17)26/h3-9H,1-2H3 |
| InChIKey | XEZYNVSOTHFKBX-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.37 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|