C27H26N2OS — CID 168828621
2-methyl-8-(5,5,8,8-tetramethyl-6,7-dihydro-[1]benzothiolo[2,3-b]pyridin-2-yl)-[1]benzofuro[2,3-b]pyridine (PubChem CID 168828621) has the molecular formula C27H26N2OS and a molecular weight of 426.59 g/mol. Its IUPAC name is 2-methyl-8-(5,5,8,8-tetramethyl-6,7-dihydro-[1]benzothiolo[2,3-b]pyridin-2-yl)-[1]benzofuro[2,3-b]pyridine.
| Compound Name | 2-methyl-8-(5,5,8,8-tetramethyl-6,7-dihydro-[1]benzothiolo[2,3-b]pyridin-2-yl)-[1]benzofuro[2,3-b]pyridine |
|---|---|
| PubChem CID | 168828621 |
| Molecular Formula | C27H26N2OS |
| Molecular Weight | 426.59 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | 2-methyl-8-(5,5,8,8-tetramethyl-6,7-dihydro-[1]benzothiolo[2,3-b]pyridin-2-yl)-[1]benzofuro[2,3-b]pyridine |
| SMILES | Cc1ccc2c(n1)oc1c(-c3ccc4c5c(sc4n3)C(C)(C)CCC5(C)C)cccc12 |
| InChI | InChI=1S/C27H26N2OS/c1-15-9-10-17-16-7-6-8-18(22(16)30-24(17)28-15)20-12-11-19-21-23(31-25(19)29-20)27(4,5)14-13-26(21,2)3/h6-12H,13-14H2,1-5H3 |
| InChIKey | UUYGSXCOGCYMEQ-UHFFFAOYSA-N |
| XLogP | 7.92 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.59 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |