C38H34IrN3OS- — CID 168828851
iridium;2-phenylpyridine;8-(5,5,8,8-tetramethyl-6,7-dihydro-[1]benzothiolo[2,3-b]pyridin-2-yl)-2-(trideuteriomethyl)-[1]benzofuro[2,3-b]pyridine (PubChem CID 168828851) has the molecular formula C38H34IrN3OS- and a molecular weight of 776.01 g/mol. Its IUPAC name is iridium;2-phenylpyridine;8-(5,5,8,8-tetramethyl-6,7-dihydro-[1]benzothiolo[2,3-b]pyridin-2-yl)-2-(trideuteriomethyl)-[1]benzofuro[2,3-b]pyridine.
| Compound Name | iridium;2-phenylpyridine;8-(5,5,8,8-tetramethyl-6,7-dihydro-[1]benzothiolo[2,3-b]pyridin-2-yl)-2-(trideuteriomethyl)-[1]benzofuro[2,3-b]pyridine |
|---|---|
| PubChem CID | 168828851 |
| Molecular Formula | C38H34IrN3OS- |
| Molecular Weight | 776.01 g/mol |
| Exact Mass | 776.22 |
| IUPAC Name | iridium;2-phenylpyridine;8-(5,5,8,8-tetramethyl-6,7-dihydro-[1]benzothiolo[2,3-b]pyridin-2-yl)-2-(trideuteriomethyl)-[1]benzofuro[2,3-b]pyridine |
| SMILES | [2H]C([2H])([2H])c1ccc2c(n1)oc1c(-c3ccc4c5c(sc4n3)C(C)(C)CCC5(C)C)cccc12.[Ir].[c-]1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C27H26N2OS.C11H8N.Ir/c1-15-9-10-17-16-7-6-8-18(22(16)30-24(17)28-15)20-12-11-19-21-23(31-25(19)29-20)27(4,5)14-13-26(21,2)3;1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h6-12H,13-14H2,1-5H3;1-6,8-9H;/q;-1;/i1D3;; |
| InChIKey | TUZYCWYUUCZQRM-GXXYEPOPSA-N |
| XLogP | 10.46 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 776.01 |
| LogP ≤ 5 | 10.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|