C25H18N4O — CID 140884093
CID 140884093 (PubChem CID 140884093) has the molecular formula C25H18N4O and a molecular weight of 390.45 g/mol.
| Compound Name | CID 140884093 |
|---|---|
| PubChem CID | 140884093 |
| Molecular Formula | C25H18N4O |
| Molecular Weight | 390.45 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | — |
| SMILES | [CH2][C]1N(c2ccccc2)c2cccnc2N1c1c(C)ccc2c1oc1ncccc12 |
| InChI | InChI=1S/C25H18N4O/c1-16-12-13-19-20-10-6-15-27-25(20)30-23(19)22(16)29-17(2)28(18-8-4-3-5-9-18)21-11-7-14-26-24(21)29/h3-15H,2H2,1H3 |
| InChIKey | ASEWYXYNEGDSIG-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 45.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.45 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |