C29H32N3O+ — CID 140940248
1-(2,6-dimethylphenyl)-3-methyl-4-propan-2-yl-5-(3-propan-2-yldibenzofuran-4-yl)-1,2,4-triazol-4-ium (PubChem CID 140940248) has the molecular formula C29H32N3O+ and a molecular weight of 438.60 g/mol. Its IUPAC name is 1-(2,6-dimethylphenyl)-3-methyl-4-propan-2-yl-5-(3-propan-2-yldibenzofuran-4-yl)-1,2,4-triazol-4-ium.
| Compound Name | 1-(2,6-dimethylphenyl)-3-methyl-4-propan-2-yl-5-(3-propan-2-yldibenzofuran-4-yl)-1,2,4-triazol-4-ium |
|---|---|
| PubChem CID | 140940248 |
| Molecular Formula | C29H32N3O+ |
| Molecular Weight | 438.60 g/mol |
| Exact Mass | 438.25 |
| IUPAC Name | 1-(2,6-dimethylphenyl)-3-methyl-4-propan-2-yl-5-(3-propan-2-yldibenzofuran-4-yl)-1,2,4-triazol-4-ium |
| SMILES | Cc1cccc(C)c1-n1nc(C)[n+](C(C)C)c1-c1c(C(C)C)ccc2c1oc1ccccc12 |
| InChI | InChI=1S/C29H32N3O/c1-17(2)22-15-16-24-23-13-8-9-14-25(23)33-28(24)26(22)29-31(18(3)4)21(7)30-32(29)27-19(5)11-10-12-20(27)6/h8-18H,1-7H3/q+1 |
| InChIKey | DVBFOIAOLDBYMN-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 34.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.60 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|