C37H39N2O+ — CID 140855388
2-(3,5-dimethylphenyl)-1-[2,6-di(propan-2-yl)phenyl]-3-methyl-4-(3-methyldibenzofuran-4-yl)imidazol-1-ium (PubChem CID 140855388) has the molecular formula C37H39N2O+ and a molecular weight of 527.73 g/mol. Its IUPAC name is 2-(3,5-dimethylphenyl)-1-[2,6-di(propan-2-yl)phenyl]-3-methyl-4-(3-methyldibenzofuran-4-yl)imidazol-1-ium.
| Compound Name | 2-(3,5-dimethylphenyl)-1-[2,6-di(propan-2-yl)phenyl]-3-methyl-4-(3-methyldibenzofuran-4-yl)imidazol-1-ium |
|---|---|
| PubChem CID | 140855388 |
| Molecular Formula | C37H39N2O+ |
| Molecular Weight | 527.73 g/mol |
| Exact Mass | 527.31 |
| IUPAC Name | 2-(3,5-dimethylphenyl)-1-[2,6-di(propan-2-yl)phenyl]-3-methyl-4-(3-methyldibenzofuran-4-yl)imidazol-1-ium |
| SMILES | Cc1cc(C)cc(-c2n(C)c(-c3c(C)ccc4c3oc3ccccc34)c[n+]2-c2c(C(C)C)cccc2C(C)C)c1 |
| InChI | InChI=1S/C37H39N2O/c1-22(2)28-13-11-14-29(23(3)4)35(28)39-21-32(38(8)37(39)27-19-24(5)18-25(6)20-27)34-26(7)16-17-31-30-12-9-10-15-33(30)40-36(31)34/h9-23H,1-8H3/q+1 |
| InChIKey | SSVQKCPLLMIIDL-UHFFFAOYSA-N |
| XLogP | 9.71 |
| TPSA | 21.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.73 |
| LogP ≤ 5 | 9.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|