C64H56N2O2 — CID 153259447
1-N,6-N-bis(3,5-dimethylphenyl)-1-N,6-N-bis(3-methyldibenzofuran-4-yl)-3,8-di(propan-2-yl)pyrene-1,6-diamine (PubChem CID 153259447) has the molecular formula C64H56N2O2 and a molecular weight of 885.16 g/mol. Its IUPAC name is 1-N,6-N-bis(3,5-dimethylphenyl)-1-N,6-N-bis(3-methyldibenzofuran-4-yl)-3,8-di(propan-2-yl)pyrene-1,6-diamine.
| Compound Name | 1-N,6-N-bis(3,5-dimethylphenyl)-1-N,6-N-bis(3-methyldibenzofuran-4-yl)-3,8-di(propan-2-yl)pyrene-1,6-diamine |
|---|---|
| PubChem CID | 153259447 |
| Molecular Formula | C64H56N2O2 |
| Molecular Weight | 885.16 g/mol |
| Exact Mass | 884.43 |
| IUPAC Name | 1-N,6-N-bis(3,5-dimethylphenyl)-1-N,6-N-bis(3-methyldibenzofuran-4-yl)-3,8-di(propan-2-yl)pyrene-1,6-diamine |
| SMILES | Cc1cc(C)cc(N(c2cc(C(C)C)c3ccc4c(N(c5cc(C)cc(C)c5)c5c(C)ccc6c5oc5ccccc56)cc(C(C)C)c5ccc2c3c54)c2c(C)ccc3c2oc2ccccc23)c1 |
| InChI | InChI=1S/C64H56N2O2/c1-35(2)53-33-55(65(43-29-37(5)27-38(6)30-43)61-41(9)19-21-49-45-15-11-13-17-57(45)67-63(49)61)51-26-24-48-54(36(3)4)34-56(52-25-23-47(53)59(51)60(48)52)66(44-31-39(7)28-40(8)32-44)62-42(10)20-22-50-46-16-12-14-18-58(46)68-64(50)62/h11-36H,1-10H3 |
| InChIKey | WUXVZIGRQRUXSD-UHFFFAOYSA-N |
| XLogP | 19.42 |
| TPSA | 32.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 885.16 |
| LogP ≤ 5 | 19.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|