C74H80N2O2Si2 — CID 153297491
1-N,6-N-bis(6-tert-butyl-3-methyldibenzofuran-4-yl)-3,8-di(propan-2-yl)-1-N,6-N-bis(4-trimethylsilylphenyl)pyrene-1,6-diamine (PubChem CID 153297491) has the molecular formula C74H80N2O2Si2 and a molecular weight of 1085.64 g/mol. Its IUPAC name is 1-N,6-N-bis(6-tert-butyl-3-methyldibenzofuran-4-yl)-3,8-di(propan-2-yl)-1-N,6-N-bis(4-trimethylsilylphenyl)pyrene-1,6-diamine.
| Compound Name | 1-N,6-N-bis(6-tert-butyl-3-methyldibenzofuran-4-yl)-3,8-di(propan-2-yl)-1-N,6-N-bis(4-trimethylsilylphenyl)pyrene-1,6-diamine |
|---|---|
| PubChem CID | 153297491 |
| Molecular Formula | C74H80N2O2Si2 |
| Molecular Weight | 1085.64 g/mol |
| Exact Mass | 1084.58 |
| IUPAC Name | 1-N,6-N-bis(6-tert-butyl-3-methyldibenzofuran-4-yl)-3,8-di(propan-2-yl)-1-N,6-N-bis(4-trimethylsilylphenyl)pyrene-1,6-diamine |
| SMILES | Cc1ccc2c(oc3c(C(C)(C)C)cccc32)c1N(c1ccc([Si](C)(C)C)cc1)c1cc(C(C)C)c2ccc3c(N(c4ccc([Si](C)(C)C)cc4)c4c(C)ccc5c4oc4c(C(C)(C)C)cccc45)cc(C(C)C)c4ccc1c2c43 |
| InChI | InChI=1S/C74H80N2O2Si2/c1-43(2)59-41-63(75(47-27-31-49(32-28-47)79(13,14)15)67-45(5)25-35-55-53-21-19-23-61(73(7,8)9)69(53)77-71(55)67)57-40-38-52-60(44(3)4)42-64(58-39-37-51(59)65(57)66(52)58)76(48-29-33-50(34-30-48)80(16,17)18)68-46(6)26-36-56-54-22-20-24-62(74(10,11)12)70(54)78-72(56)68/h19-44H,1-18H3 |
| InChIKey | JQRAACIFAMEJTI-UHFFFAOYSA-N |
| XLogP | 21.87 |
| TPSA | 32.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 80 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1085.64 |
| LogP ≤ 5 | 21.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|