C63H59N2O2Si2+ — CID 144918830
[4-[dibenzofuran-4-yl-[6-(N-dibenzofuran-4-yl-4-trimethylsilylanilino)-3,8-di(propan-2-yl)pyren-1-yl]amino]phenyl]-dimethylsilanylium (PubChem CID 144918830) has the molecular formula C63H59N2O2Si2+ and a molecular weight of 932.35 g/mol. Its IUPAC name is [4-[dibenzofuran-4-yl-[6-(N-dibenzofuran-4-yl-4-trimethylsilylanilino)-3,8-di(propan-2-yl)pyren-1-yl]amino]phenyl]-dimethylsilanylium.
| Compound Name | [4-[dibenzofuran-4-yl-[6-(N-dibenzofuran-4-yl-4-trimethylsilylanilino)-3,8-di(propan-2-yl)pyren-1-yl]amino]phenyl]-dimethylsilanylium |
|---|---|
| PubChem CID | 144918830 |
| Molecular Formula | C63H59N2O2Si2+ |
| Molecular Weight | 932.35 g/mol |
| Exact Mass | 931.41 |
| IUPAC Name | [4-[dibenzofuran-4-yl-[6-(N-dibenzofuran-4-yl-4-trimethylsilylanilino)-3,8-di(propan-2-yl)pyren-1-yl]amino]phenyl]-dimethylsilanylium |
| SMILES | CC(C)c1cc(N(c2ccc([SiH2+](C)C)cc2)c2cccc3c2oc2ccccc23)c2ccc3c(C(C)C)cc(N(c4ccc([Si](C)(C)C)cc4)c4cccc5c4oc4ccccc45)c4ccc1c2c34 |
| InChI | InChI=1S/C63H59N2O2Si2/c1-38(2)52-36-56(64(40-24-28-42(29-25-40)68(5)6)54-20-14-18-48-44-16-10-12-22-58(44)66-62(48)54)50-34-32-47-53(39(3)4)37-57(51-35-33-46(52)60(50)61(47)51)65(41-26-30-43(31-27-41)69(7,8)9)55-21-15-19-49-45-17-11-13-23-59(45)67-63(49)55/h10-39H,68H2,1-9H3/q+1 |
| InChIKey | LNJUGMZPFICIOV-UHFFFAOYSA-N |
| XLogP | 17.54 |
| TPSA | 32.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 932.35 |
| LogP ≤ 5 | 17.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|