C64H60N2OSSi2 — CID 171595842
6-N-dibenzofuran-4-yl-1-N-dibenzothiophen-4-yl-3,8-di(propan-2-yl)-1-N,6-N-bis(4-trimethylsilylphenyl)pyrene-1,6-diamine (PubChem CID 171595842) has the molecular formula C64H60N2OSSi2 and a molecular weight of 961.44 g/mol. Its IUPAC name is 6-N-dibenzofuran-4-yl-1-N-dibenzothiophen-4-yl-3,8-di(propan-2-yl)-1-N,6-N-bis(4-trimethylsilylphenyl)pyrene-1,6-diamine.
| Compound Name | 6-N-dibenzofuran-4-yl-1-N-dibenzothiophen-4-yl-3,8-di(propan-2-yl)-1-N,6-N-bis(4-trimethylsilylphenyl)pyrene-1,6-diamine |
|---|---|
| PubChem CID | 171595842 |
| Molecular Formula | C64H60N2OSSi2 |
| Molecular Weight | 961.44 g/mol |
| Exact Mass | 960.40 |
| IUPAC Name | 6-N-dibenzofuran-4-yl-1-N-dibenzothiophen-4-yl-3,8-di(propan-2-yl)-1-N,6-N-bis(4-trimethylsilylphenyl)pyrene-1,6-diamine |
| SMILES | CC(C)c1cc(N(c2ccc([Si](C)(C)C)cc2)c2cccc3c2oc2ccccc23)c2ccc3c(C(C)C)cc(N(c4ccc([Si](C)(C)C)cc4)c4cccc5c4sc4ccccc45)c4ccc1c2c34 |
| InChI | InChI=1S/C64H60N2OSSi2/c1-39(2)53-37-57(65(41-25-29-43(30-26-41)69(5,6)7)55-21-15-19-49-45-17-11-13-23-59(45)67-63(49)55)51-35-33-48-54(40(3)4)38-58(52-36-34-47(53)61(51)62(48)52)66(42-27-31-44(32-28-42)70(8,9)10)56-22-16-20-50-46-18-12-14-24-60(46)68-64(50)56/h11-40H,1-10H3 |
| InChIKey | FQAORMVZSKKJOW-UHFFFAOYSA-N |
| XLogP | 19.13 |
| TPSA | 19.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 961.44 |
| LogP ≤ 5 | 19.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|