C22H21IN2O — CID 170120197
(2R)-1,2-dimethyl-3-(4-methylnaphtho[2,3-b][1]benzofuran-3-yl)-1,2-dihydroimidazol-1-ium iodide (PubChem CID 170120197) has the molecular formula C22H21IN2O and a molecular weight of 456.33 g/mol. Its IUPAC name is (2R)-1,2-dimethyl-3-(4-methylnaphtho[2,3-b][1]benzofuran-3-yl)-1,2-dihydroimidazol-1-ium iodide.
| Compound Name | (2R)-1,2-dimethyl-3-(4-methylnaphtho[2,3-b][1]benzofuran-3-yl)-1,2-dihydroimidazol-1-ium iodide |
|---|---|
| PubChem CID | 170120197 |
| Molecular Formula | C22H21IN2O |
| Molecular Weight | 456.33 g/mol |
| Exact Mass | 456.07 |
| IUPAC Name | (2R)-1,2-dimethyl-3-(4-methylnaphtho[2,3-b][1]benzofuran-3-yl)-1,2-dihydroimidazol-1-ium iodide |
| SMILES | Cc1c(N2C=C[NH+](C)[C@@H]2C)ccc2c1oc1cc3ccccc3cc12.[I-] |
| InChI | InChI=1S/C22H20N2O.HI/c1-14-20(24-11-10-23(3)15(24)2)9-8-18-19-12-16-6-4-5-7-17(16)13-21(19)25-22(14)18;/h4-13,15H,1-3H3;1H/t15-;/m0./s1 |
| InChIKey | FUFHLHFIFFSAKT-RSAXXLAASA-N |
| XLogP | 1.20 |
| TPSA | 20.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.33 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|