C21H21NO — CID 144815866
1,4,5-trimethyl-2-(3-methyldibenzofuran-4-yl)-2H-pyridine (PubChem CID 144815866) has the molecular formula C21H21NO and a molecular weight of 303.40 g/mol. Its IUPAC name is 1,4,5-trimethyl-2-(3-methyldibenzofuran-4-yl)-2H-pyridine.
| Compound Name | 1,4,5-trimethyl-2-(3-methyldibenzofuran-4-yl)-2H-pyridine |
|---|---|
| PubChem CID | 144815866 |
| Molecular Formula | C21H21NO |
| Molecular Weight | 303.40 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | 1,4,5-trimethyl-2-(3-methyldibenzofuran-4-yl)-2H-pyridine |
| SMILES | CC1=CC(c2c(C)ccc3c2oc2ccccc23)N(C)C=C1C |
| InChI | InChI=1S/C21H21NO/c1-13-9-10-17-16-7-5-6-8-19(16)23-21(17)20(13)18-11-14(2)15(3)12-22(18)4/h5-12,18H,1-4H3 |
| InChIKey | QLNDAHAWSBBFSC-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.40 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |