C18H18O — CID 157279405
4-(1-deuteriocyclohexyl)dibenzofuran (PubChem CID 157279405) has the molecular formula C18H18O and a molecular weight of 251.35 g/mol. Its IUPAC name is 4-(1-deuteriocyclohexyl)dibenzofuran.
| Compound Name | 4-(1-deuteriocyclohexyl)dibenzofuran |
|---|---|
| PubChem CID | 157279405 |
| Molecular Formula | C18H18O |
| Molecular Weight | 251.35 g/mol |
| Exact Mass | 251.14 |
| IUPAC Name | 4-(1-deuteriocyclohexyl)dibenzofuran |
| SMILES | [2H]C1(c2cccc3c2oc2ccccc23)CCCCC1 |
| InChI | InChI=1S/C18H18O/c1-2-7-13(8-3-1)14-10-6-11-16-15-9-4-5-12-17(15)19-18(14)16/h4-6,9-13H,1-3,7-8H2/i13D |
| InChIKey | NRNYMDSTYLRSEB-YSOHJTORSA-N |
| XLogP | 5.63 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.35 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |