C18H18O — CID 163628573
2-cyclohexyldibenzofuran (PubChem CID 163628573) has the molecular formula C18H18O and a molecular weight of 250.34 g/mol. Its IUPAC name is 2-cyclohexyldibenzofuran.
| Compound Name | 2-cyclohexyldibenzofuran |
|---|---|
| PubChem CID | 163628573 |
| Molecular Formula | C18H18O |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | 2-cyclohexyldibenzofuran |
| SMILES | c1ccc2c(c1)oc1ccc(C3CCCCC3)cc12 |
| InChI | InChI=1S/C18H18O/c1-2-6-13(7-3-1)14-10-11-18-16(12-14)15-8-4-5-9-17(15)19-18/h4-5,8-13H,1-3,6-7H2 |
| InChIKey | HUCMICBGENQTKR-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |