C21H22O2S — CID 139080616
5-cyclohexyl-3-[(S)-methylsulfinyl]-2-phenyl-1-benzofuran (PubChem CID 139080616) has the molecular formula C21H22O2S and a molecular weight of 338.47 g/mol. Its IUPAC name is 5-cyclohexyl-3-[(S)-methylsulfinyl]-2-phenyl-1-benzofuran.
| Compound Name | 5-cyclohexyl-3-[(S)-methylsulfinyl]-2-phenyl-1-benzofuran |
|---|---|
| PubChem CID | 139080616 |
| Molecular Formula | C21H22O2S |
| Molecular Weight | 338.47 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | 5-cyclohexyl-3-[(S)-methylsulfinyl]-2-phenyl-1-benzofuran |
| SMILES | C[S@](=O)c1c(-c2ccccc2)oc2ccc(C3CCCCC3)cc12 |
| InChI | InChI=1S/C21H22O2S/c1-24(22)21-18-14-17(15-8-4-2-5-9-15)12-13-19(18)23-20(21)16-10-6-3-7-11-16/h3,6-7,10-15H,2,4-5,8-9H2,1H3/t24-/m0/s1 |
| InChIKey | VYBOWZATNAALQC-DEOSSOPVSA-N |
| XLogP | 5.88 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.47 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |