C16H12O4S — CID 139071244
7-[(R)-methylsulfinyl]-6-phenylfuro[2,3-f][1,3]benzodioxole (PubChem CID 139071244) has the molecular formula C16H12O4S and a molecular weight of 300.33 g/mol. Its IUPAC name is 7-[(R)-methylsulfinyl]-6-phenylfuro[2,3-f][1,3]benzodioxole.
| Compound Name | 7-[(R)-methylsulfinyl]-6-phenylfuro[2,3-f][1,3]benzodioxole |
|---|---|
| PubChem CID | 139071244 |
| Molecular Formula | C16H12O4S |
| Molecular Weight | 300.33 g/mol |
| Exact Mass | 300.05 |
| IUPAC Name | 7-[(R)-methylsulfinyl]-6-phenylfuro[2,3-f][1,3]benzodioxole |
| SMILES | C[S@@](=O)c1c(-c2ccccc2)oc2cc3c(cc12)OCO3 |
| InChI | InChI=1S/C16H12O4S/c1-21(17)16-11-7-13-14(19-9-18-13)8-12(11)20-15(16)10-5-3-2-4-6-10/h2-8H,9H2,1H3/t21-/m1/s1 |
| InChIKey | MWKJQTXKQQBEEE-OAQYLSRUSA-N |
| XLogP | 3.57 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.33 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |