C21H21FO2S — CID 139085700
5-cyclohexyl-3-[(R)-(3-fluorophenyl)sulfinyl]-2-methyl-1-benzofuran (PubChem CID 139085700) has the molecular formula C21H21FO2S and a molecular weight of 356.46 g/mol. Its IUPAC name is 5-cyclohexyl-3-[(R)-(3-fluorophenyl)sulfinyl]-2-methyl-1-benzofuran.
| Compound Name | 5-cyclohexyl-3-[(R)-(3-fluorophenyl)sulfinyl]-2-methyl-1-benzofuran |
|---|---|
| PubChem CID | 139085700 |
| Molecular Formula | C21H21FO2S |
| Molecular Weight | 356.46 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | 5-cyclohexyl-3-[(R)-(3-fluorophenyl)sulfinyl]-2-methyl-1-benzofuran |
| SMILES | Cc1oc2ccc(C3CCCCC3)cc2c1[S@](=O)c1cccc(F)c1 |
| InChI | InChI=1S/C21H21FO2S/c1-14-21(25(23)18-9-5-8-17(22)13-18)19-12-16(10-11-20(19)24-14)15-6-3-2-4-7-15/h5,8-13,15H,2-4,6-7H2,1H3/t25-/m1/s1 |
| InChIKey | KSFKEKFHEOAZSW-RUZDIDTESA-N |
| XLogP | 6.09 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.46 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |