C18H18S — CID 154097064
2-cyclohexyldibenzothiophene (PubChem CID 154097064) has the molecular formula C18H18S and a molecular weight of 266.41 g/mol. Its IUPAC name is 2-cyclohexyldibenzothiophene.
| Compound Name | 2-cyclohexyldibenzothiophene |
|---|---|
| PubChem CID | 154097064 |
| Molecular Formula | C18H18S |
| Molecular Weight | 266.41 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | 2-cyclohexyldibenzothiophene |
| SMILES | c1ccc2c(c1)sc1ccc(C3CCCCC3)cc12 |
| InChI | InChI=1S/C18H18S/c1-2-6-13(7-3-1)14-10-11-18-16(12-14)15-8-4-5-9-17(15)19-18/h4-5,8-13H,1-3,6-7H2 |
| InChIKey | KSSFNRLJBBVWDI-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.41 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |