C24H22O3S2 — CID 132820197
phenyl 8-cyclohexyldibenzothiophene-2-sulfonate (PubChem CID 132820197) has the molecular formula C24H22O3S2 and a molecular weight of 422.57 g/mol. Its IUPAC name is phenyl 8-cyclohexyldibenzothiophene-2-sulfonate.
| Compound Name | phenyl 8-cyclohexyldibenzothiophene-2-sulfonate |
|---|---|
| PubChem CID | 132820197 |
| Molecular Formula | C24H22O3S2 |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.10 |
| IUPAC Name | phenyl 8-cyclohexyldibenzothiophene-2-sulfonate |
| SMILES | O=S(=O)(Oc1ccccc1)c1ccc2sc3ccc(C4CCCCC4)cc3c2c1 |
| InChI | InChI=1S/C24H22O3S2/c25-29(26,27-19-9-5-2-6-10-19)20-12-14-24-22(16-20)21-15-18(11-13-23(21)28-24)17-7-3-1-4-8-17/h2,5-6,9-17H,1,3-4,7-8H2 |
| InChIKey | DTDAOXKVPRRHQT-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|