C19H16O — CID 142397321
4-(3-methylcyclohexa-2,4-dien-1-yl)dibenzofuran (PubChem CID 142397321) has the molecular formula C19H16O and a molecular weight of 260.34 g/mol. Its IUPAC name is 4-(3-methylcyclohexa-2,4-dien-1-yl)dibenzofuran.
| Compound Name | 4-(3-methylcyclohexa-2,4-dien-1-yl)dibenzofuran |
|---|---|
| PubChem CID | 142397321 |
| Molecular Formula | C19H16O |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | 4-(3-methylcyclohexa-2,4-dien-1-yl)dibenzofuran |
| SMILES | CC1=CC(c2cccc3c2oc2ccccc23)CC=C1 |
| InChI | InChI=1S/C19H16O/c1-13-6-4-7-14(12-13)15-9-5-10-17-16-8-2-3-11-18(16)20-19(15)17/h2-6,8-12,14H,7H2,1H3 |
| InChIKey | FUHNVVMBZLIBSD-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |