C24H19NO — CID 167067495
N-[(1R)-3-phenylcyclohexa-2,4-dien-1-yl]dibenzofuran-4-amine (PubChem CID 167067495) has the molecular formula C24H19NO and a molecular weight of 337.42 g/mol. Its IUPAC name is N-[(1R)-3-phenylcyclohexa-2,4-dien-1-yl]dibenzofuran-4-amine.
| Compound Name | N-[(1R)-3-phenylcyclohexa-2,4-dien-1-yl]dibenzofuran-4-amine |
|---|---|
| PubChem CID | 167067495 |
| Molecular Formula | C24H19NO |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | N-[(1R)-3-phenylcyclohexa-2,4-dien-1-yl]dibenzofuran-4-amine |
| SMILES | C1=CC(c2ccccc2)=C[C@H](Nc2cccc3c2oc2ccccc23)C1 |
| InChI | InChI=1S/C24H19NO/c1-2-8-17(9-3-1)18-10-6-11-19(16-18)25-22-14-7-13-21-20-12-4-5-15-23(20)26-24(21)22/h1-10,12-16,19,25H,11H2/t19-/m1/s1 |
| InChIKey | YCYQPILEZJIFMO-LJQANCHMSA-N |
| XLogP | 6.41 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |