C20H18O — CID 146532512
6-methyl-2-(3-methylcyclohexa-1,5-dien-1-yl)dibenzofuran (PubChem CID 146532512) has the molecular formula C20H18O and a molecular weight of 274.36 g/mol. Its IUPAC name is 6-methyl-2-(3-methylcyclohexa-1,5-dien-1-yl)dibenzofuran.
| Compound Name | 6-methyl-2-(3-methylcyclohexa-1,5-dien-1-yl)dibenzofuran |
|---|---|
| PubChem CID | 146532512 |
| Molecular Formula | C20H18O |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | 6-methyl-2-(3-methylcyclohexa-1,5-dien-1-yl)dibenzofuran |
| SMILES | Cc1cccc2c1oc1ccc(C3=CC(C)CC=C3)cc12 |
| InChI | InChI=1S/C20H18O/c1-13-5-3-7-15(11-13)16-9-10-19-18(12-16)17-8-4-6-14(2)20(17)21-19/h3-4,6-13H,5H2,1-2H3 |
| InChIKey | IVOCBFDHZSCTSP-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |