C22H26N2O4S2 — CID 102278311
2,8,11,17-tetraoxa-5,14-dithia-23,26-diazatetracyclo[16.12.0.019,24.025,30]triaconta-1(18),19(24),20,22,25(30),26,28-heptaene (PubChem CID 102278311) has the molecular formula C22H26N2O4S2 and a molecular weight of 446.59 g/mol. Its IUPAC name is 2,8,11,17-tetraoxa-5,14-dithia-23,26-diazatetracyclo[16.12.0.019,24.025,30]triaconta-1(18),19(24),20,22,25(30),26,28-heptaene.
| Compound Name | 2,8,11,17-tetraoxa-5,14-dithia-23,26-diazatetracyclo[16.12.0.019,24.025,30]triaconta-1(18),19(24),20,22,25(30),26,28-heptaene |
|---|---|
| PubChem CID | 102278311 |
| Molecular Formula | C22H26N2O4S2 |
| Molecular Weight | 446.59 g/mol |
| Exact Mass | 446.13 |
| IUPAC Name | 2,8,11,17-tetraoxa-5,14-dithia-23,26-diazatetracyclo[16.12.0.019,24.025,30]triaconta-1(18),19(24),20,22,25(30),26,28-heptaene |
| SMILES | c1cnc2c(c1)c1c(c3cccnc32)OCCSCCOCCOCCSCCO1 |
| InChI | InChI=1S/C22H26N2O4S2/c1-3-17-19(23-5-1)20-18(4-2-6-24-20)22-21(17)27-11-15-29-13-9-25-7-8-26-10-14-30-16-12-28-22/h1-6H,7-16H2 |
| InChIKey | SBHGRZKTGBPWLQ-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 62.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.59 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|