C12H6N4S — CID 56941578
[1,2,5]thiadiazolo[3,4-f][1,10]phenanthroline (PubChem CID 56941578) has the molecular formula C12H6N4S and a molecular weight of 238.28 g/mol. Its IUPAC name is [1,2,5]thiadiazolo[3,4-f][1,10]phenanthroline.
| Compound Name | [1,2,5]thiadiazolo[3,4-f][1,10]phenanthroline |
|---|---|
| PubChem CID | 56941578 |
| Molecular Formula | C12H6N4S |
| Molecular Weight | 238.28 g/mol |
| Exact Mass | 238.03 |
| IUPAC Name | [1,2,5]thiadiazolo[3,4-f][1,10]phenanthroline |
| SMILES | c1cnc2c(c1)c1nsnc1c1cccnc12 |
| InChI | InChI=1S/C12H6N4S/c1-3-7-9(13-5-1)10-8(4-2-6-14-10)12-11(7)15-17-16-12/h1-6H |
| InChIKey | ZKYLQHPERJLTRL-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.28 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|