C13H7NS2 — CID 174903918
3,8-dithia-13-azatetracyclo[10.4.0.02,6.07,11]hexadeca-1(12),2(6),4,7(11),9,13,15-heptaene (PubChem CID 174903918) has the molecular formula C13H7NS2 and a molecular weight of 241.34 g/mol. Its IUPAC name is 3,8-dithia-13-azatetracyclo[10.4.0.02,6.07,11]hexadeca-1(12),2(6),4,7(11),9,13,15-heptaene.
| Compound Name | 3,8-dithia-13-azatetracyclo[10.4.0.02,6.07,11]hexadeca-1(12),2(6),4,7(11),9,13,15-heptaene |
|---|---|
| PubChem CID | 174903918 |
| Molecular Formula | C13H7NS2 |
| Molecular Weight | 241.34 g/mol |
| Exact Mass | 241.00 |
| IUPAC Name | 3,8-dithia-13-azatetracyclo[10.4.0.02,6.07,11]hexadeca-1(12),2(6),4,7(11),9,13,15-heptaene |
| SMILES | c1cnc2c(c1)c1sccc1c1sccc21 |
| InChI | InChI=1S/C13H7NS2/c1-2-8-11(14-5-1)9-3-6-15-13(9)10-4-7-16-12(8)10/h1-7H |
| InChIKey | IALWVOSVBQEAON-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.34 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |