C13H17N3O4 — CID 100950545
6,9-dioxa-3,12,15-triazabicyclo[12.4.0]octadeca-1(14),15,17-triene-2,13-dione (PubChem CID 100950545) has the molecular formula C13H17N3O4 and a molecular weight of 279.30 g/mol. Its IUPAC name is 6,9-dioxa-3,12,15-triazabicyclo[12.4.0]octadeca-1(14),15,17-triene-2,13-dione.
| Compound Name | 6,9-dioxa-3,12,15-triazabicyclo[12.4.0]octadeca-1(14),15,17-triene-2,13-dione |
|---|---|
| PubChem CID | 100950545 |
| Molecular Formula | C13H17N3O4 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | 6,9-dioxa-3,12,15-triazabicyclo[12.4.0]octadeca-1(14),15,17-triene-2,13-dione |
| SMILES | O=C1NCCOCCOCCNC(=O)c2ncccc21 |
| InChI | InChI=1S/C13H17N3O4/c17-12-10-2-1-3-14-11(10)13(18)16-5-7-20-9-8-19-6-4-15-12/h1-3H,4-9H2,(H,15,17)(H,16,18) |
| InChIKey | TXTSYZWNSMLZAF-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |