C14H12N4O2 — CID 11000045
3,9,12,18-tetrazatricyclo[12.4.0.02,7]octadeca-1(14),2(7),3,5,15,17-hexaene-8,13-dione (PubChem CID 11000045) has the molecular formula C14H12N4O2 and a molecular weight of 268.28 g/mol. Its IUPAC name is 3,9,12,18-tetrazatricyclo[12.4.0.02,7]octadeca-1(14),2(7),3,5,15,17-hexaene-8,13-dione.
| Compound Name | 3,9,12,18-tetrazatricyclo[12.4.0.02,7]octadeca-1(14),2(7),3,5,15,17-hexaene-8,13-dione |
|---|---|
| PubChem CID | 11000045 |
| Molecular Formula | C14H12N4O2 |
| Molecular Weight | 268.28 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | 3,9,12,18-tetrazatricyclo[12.4.0.02,7]octadeca-1(14),2(7),3,5,15,17-hexaene-8,13-dione |
| SMILES | O=C1NCCNC(=O)c2cccnc2-c2ncccc21 |
| InChI | InChI=1S/C14H12N4O2/c19-13-9-3-1-5-15-11(9)12-10(4-2-6-16-12)14(20)18-8-7-17-13/h1-6H,7-8H2,(H,17,19)(H,18,20) |
| InChIKey | GZLURQSVQMDESN-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.28 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |