C12H6N2O2 — CID 6764
4,7-phenanthroline-5,6-dione (PubChem CID 6764) has the molecular formula C12H6N2O2 and a molecular weight of 210.19 g/mol. Its IUPAC name is 4,7-phenanthroline-5,6-dione.
| Compound Name | 4,7-phenanthroline-5,6-dione |
|---|---|
| PubChem CID | 6764 |
| Molecular Formula | C12H6N2O2 |
| Molecular Weight | 210.19 g/mol |
| Exact Mass | 210.04 |
| IUPAC Name | 4,7-phenanthroline-5,6-dione |
| SMILES | O=C1C(=O)c2ncccc2-c2cccnc21 |
| InChI | InChI=1S/C12H6N2O2/c15-11-9-7(3-1-5-13-9)8-4-2-6-14-10(8)12(11)16/h1-6H |
| InChIKey | VLPADTBFADIFKG-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.19 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|