C11H6N2O3 — CID 118219007
2-methyl-[1,3]oxazolo[4,5-f]quinoline-4,5-dione (PubChem CID 118219007) has the molecular formula C11H6N2O3 and a molecular weight of 214.18 g/mol. Its IUPAC name is 2-methyl-[1,3]oxazolo[4,5-f]quinoline-4,5-dione.
| Compound Name | 2-methyl-[1,3]oxazolo[4,5-f]quinoline-4,5-dione |
|---|---|
| PubChem CID | 118219007 |
| Molecular Formula | C11H6N2O3 |
| Molecular Weight | 214.18 g/mol |
| Exact Mass | 214.04 |
| IUPAC Name | 2-methyl-[1,3]oxazolo[4,5-f]quinoline-4,5-dione |
| SMILES | Cc1nc2c(o1)C(=O)C(=O)c1ncccc1-2 |
| InChI | InChI=1S/C11H6N2O3/c1-5-13-8-6-3-2-4-12-7(6)9(14)10(15)11(8)16-5/h2-4H,1H3 |
| InChIKey | GQFMLXFXBOJIBE-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 73.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.18 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|