C17H10N2O2 — CID 176653841
7-methylbenzo[b][1,10]phenanthroline-5,6-dione (PubChem CID 176653841) has the molecular formula C17H10N2O2 and a molecular weight of 274.28 g/mol. Its IUPAC name is 7-methylbenzo[b][1,10]phenanthroline-5,6-dione.
| Compound Name | 7-methylbenzo[b][1,10]phenanthroline-5,6-dione |
|---|---|
| PubChem CID | 176653841 |
| Molecular Formula | C17H10N2O2 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.07 |
| IUPAC Name | 7-methylbenzo[b][1,10]phenanthroline-5,6-dione |
| SMILES | Cc1c2c(nc3ccccc13)-c1ncccc1C(=O)C2=O |
| InChI | InChI=1S/C17H10N2O2/c1-9-10-5-2-3-7-12(10)19-15-13(9)17(21)16(20)11-6-4-8-18-14(11)15/h2-8H,1H3 |
| InChIKey | JDHZGEXGYAYIDL-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|