C17H9NO2 — CID 126542594
naphtho[1,2-h]quinoline-11,12-dione (PubChem CID 126542594) has the molecular formula C17H9NO2 and a molecular weight of 259.26 g/mol. Its IUPAC name is naphtho[1,2-h]quinoline-11,12-dione.
| Compound Name | naphtho[1,2-h]quinoline-11,12-dione |
|---|---|
| PubChem CID | 126542594 |
| Molecular Formula | C17H9NO2 |
| Molecular Weight | 259.26 g/mol |
| Exact Mass | 259.06 |
| IUPAC Name | naphtho[1,2-h]quinoline-11,12-dione |
| SMILES | O=C1C(=O)c2c(ccc3ccccc23)-c2ncccc21 |
| InChI | InChI=1S/C17H9NO2/c19-16-13-6-3-9-18-15(13)12-8-7-10-4-1-2-5-11(10)14(12)17(16)20/h1-9H |
| InChIKey | WAYAQERYHPQJPM-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.26 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|