C20H12N2O2 — CID 46193683
12-methylquinolino[7,6-a]carbazole-5,13-dione (PubChem CID 46193683) has the molecular formula C20H12N2O2 and a molecular weight of 312.33 g/mol. Its IUPAC name is 12-methylquinolino[7,6-a]carbazole-5,13-dione.
| Compound Name | 12-methylquinolino[7,6-a]carbazole-5,13-dione |
|---|---|
| PubChem CID | 46193683 |
| Molecular Formula | C20H12N2O2 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | 12-methylquinolino[7,6-a]carbazole-5,13-dione |
| SMILES | Cn1c2ccccc2c2ccc3c(c21)C(=O)c1ncccc1C3=O |
| InChI | InChI=1S/C20H12N2O2/c1-22-15-7-3-2-5-11(15)12-8-9-13-16(18(12)22)20(24)17-14(19(13)23)6-4-10-21-17/h2-10H,1H3 |
| InChIKey | IBKPASQQVVLOAB-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|