C20H12N4O3 — CID 155813737
13-hydroxy-23-methyl-3,5,13,23-tetrazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4(9),5,7,10,15,17,19,21-nonaene-12,14-dione (PubChem CID 155813737) has the molecular formula C20H12N4O3 and a molecular weight of 356.34 g/mol. Its IUPAC name is 13-hydroxy-23-methyl-3,5,13,23-tetrazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4(9),5,7,10,15,17,19,21-nonaene-12,14-dione.
| Compound Name | 13-hydroxy-23-methyl-3,5,13,23-tetrazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4(9),5,7,10,15,17,19,21-nonaene-12,14-dione |
|---|---|
| PubChem CID | 155813737 |
| Molecular Formula | C20H12N4O3 |
| Molecular Weight | 356.34 g/mol |
| Exact Mass | 356.09 |
| IUPAC Name | 13-hydroxy-23-methyl-3,5,13,23-tetrazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4(9),5,7,10,15,17,19,21-nonaene-12,14-dione |
| SMILES | Cn1c2ccccc2c2c3c(c4c5cccnc5[nH]c4c21)C(=O)N(O)C3=O |
| InChI | InChI=1S/C20H12N4O3/c1-23-11-7-3-2-5-9(11)13-15-14(19(25)24(27)20(15)26)12-10-6-4-8-21-18(10)22-16(12)17(13)23/h2-8,27H,1H3,(H,21,22) |
| InChIKey | UYDMKLMGZPFYIB-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.34 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|