C25H20N4O7 — CID 22244079
23-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-3,5,13,23-tetrazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4(9),5,7,10,15,17,19,21-nonaene-12,14-dione (PubChem CID 22244079) has the molecular formula C25H20N4O7 and a molecular weight of 488.46 g/mol. Its IUPAC name is 23-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-3,5,13,23-tetrazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4(9),5,7,10,15,17,19,21-nonaene-12,14-dione.
| Compound Name | 23-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-3,5,13,23-tetrazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4(9),5,7,10,15,17,19,21-nonaene-12,14-dione |
|---|---|
| PubChem CID | 22244079 |
| Molecular Formula | C25H20N4O7 |
| Molecular Weight | 488.46 g/mol |
| Exact Mass | 488.13 |
| IUPAC Name | 23-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-3,5,13,23-tetrazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4(9),5,7,10,15,17,19,21-nonaene-12,14-dione |
| SMILES | O=C1NC(=O)c2c1c1c3cccnc3[nH]c1c1c2c2ccccc2n1C1OC(CO)C(O)C(O)C1O |
| InChI | InChI=1S/C25H20N4O7/c30-8-12-19(31)20(32)21(33)25(36-12)29-11-6-2-1-4-9(11)14-16-15(23(34)28-24(16)35)13-10-5-3-7-26-22(10)27-17(13)18(14)29/h1-7,12,19-21,25,30-33H,8H2,(H,26,27)(H,28,34,35) |
| InChIKey | WNIMDBQMVRWWCT-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 169.93 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.46 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|