C27H23N3O7 — CID 10323743
3-[(2R,3R,4R,5S,6R)-3,4-dihydroxy-6-(hydroxymethyl)-5-methoxyoxan-2-yl]-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4,6,8,10,15,17,19,21-nonaene-12,14-dione (PubChem CID 10323743) has the molecular formula C27H23N3O7 and a molecular weight of 501.50 g/mol. Its IUPAC name is 3-[(2R,3R,4R,5S,6R)-3,4-dihydroxy-6-(hydroxymethyl)-5-methoxyoxan-2-yl]-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4,6,8,10,15,17,19,21-nonaene-12,14-dione.
| Compound Name | 3-[(2R,3R,4R,5S,6R)-3,4-dihydroxy-6-(hydroxymethyl)-5-methoxyoxan-2-yl]-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4,6,8,10,15,17,19,21-nonaene-12,14-dione |
|---|---|
| PubChem CID | 10323743 |
| Molecular Formula | C27H23N3O7 |
| Molecular Weight | 501.50 g/mol |
| Exact Mass | 501.15 |
| IUPAC Name | 3-[(2R,3R,4R,5S,6R)-3,4-dihydroxy-6-(hydroxymethyl)-5-methoxyoxan-2-yl]-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4,6,8,10,15,17,19,21-nonaene-12,14-dione |
| SMILES | CO[C@H]1[C@H](O)[C@@H](O)[C@H](n2c3ccccc3c3c4c(c5c6ccccc6[nH]c5c32)C(=O)NC4=O)O[C@@H]1CO |
| InChI | InChI=1S/C27H23N3O7/c1-36-24-15(10-31)37-27(23(33)22(24)32)30-14-9-5-3-7-12(14)17-19-18(25(34)29-26(19)35)16-11-6-2-4-8-13(11)28-20(16)21(17)30/h2-9,15,22-24,27-28,31-33H,10H2,1H3,(H,29,34,35)/t15-,22-,23-,24-,27-/m1/s1 |
| InChIKey | JNMXCWUKDUQJFF-HHJYCPGKSA-N |
| XLogP | 1.94 |
| TPSA | 146.04 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.50 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|