C25H19N3O6 — CID 11351560
3-[(3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4,6,8,10,15,17,19,21-nonaene-12,14-dione (PubChem CID 11351560) has the molecular formula C25H19N3O6 and a molecular weight of 457.44 g/mol. Its IUPAC name is 3-[(3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4,6,8,10,15,17,19,21-nonaene-12,14-dione.
| Compound Name | 3-[(3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4,6,8,10,15,17,19,21-nonaene-12,14-dione |
|---|---|
| PubChem CID | 11351560 |
| Molecular Formula | C25H19N3O6 |
| Molecular Weight | 457.44 g/mol |
| Exact Mass | 457.13 |
| IUPAC Name | 3-[(3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4,6,8,10,15,17,19,21-nonaene-12,14-dione |
| SMILES | O=C1NC(=O)c2c1c1c3ccccc3[nH]c1c1c2c2ccccc2n1C1OC[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C25H19N3O6/c29-14-9-34-25(22(31)21(14)30)28-13-8-4-2-6-11(13)16-18-17(23(32)27-24(18)33)15-10-5-1-3-7-12(10)26-19(15)20(16)28/h1-8,14,21-22,25-26,29-31H,9H2,(H,27,32,33)/t14-,21+,22-,25?/m1/s1 |
| InChIKey | RFBNARAXABPIJF-DNOJXAQFSA-N |
| XLogP | 1.92 |
| TPSA | 136.81 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.44 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|