C28H23N3O6 — CID 58936689
[(1R,2S,3S)-4-(12,14-dioxo-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4,6,8,10,15,17,19,21-nonaen-3-yl)-2,3-dihydroxycyclohexyl] acetate (PubChem CID 58936689) has the molecular formula C28H23N3O6 and a molecular weight of 497.51 g/mol. Its IUPAC name is [(1R,2S,3S)-4-(12,14-dioxo-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4,6,8,10,15,17,19,21-nonaen-3-yl)-2,3-dihydroxycyclohexyl] acetate.
| Compound Name | [(1R,2S,3S)-4-(12,14-dioxo-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4,6,8,10,15,17,19,21-nonaen-3-yl)-2,3-dihydroxycyclohexyl] acetate |
|---|---|
| PubChem CID | 58936689 |
| Molecular Formula | C28H23N3O6 |
| Molecular Weight | 497.51 g/mol |
| Exact Mass | 497.16 |
| IUPAC Name | [(1R,2S,3S)-4-(12,14-dioxo-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4,6,8,10,15,17,19,21-nonaen-3-yl)-2,3-dihydroxycyclohexyl] acetate |
| SMILES | CC(=O)O[C@@H]1CCC(n2c3ccccc3c3c4c(c5c6ccccc6[nH]c5c32)C(=O)NC4=O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C28H23N3O6/c1-12(32)37-18-11-10-17(25(33)26(18)34)31-16-9-5-3-7-14(16)20-22-21(27(35)30-28(22)36)19-13-6-2-4-8-15(13)29-23(19)24(20)31/h2-9,17-18,25-26,29,33-34H,10-11H2,1H3,(H,30,35,36)/t17?,18-,25+,26-/m1/s1 |
| InChIKey | VDWNITWFYFEAKZ-TYHKVRJESA-N |
| XLogP | 3.30 |
| TPSA | 133.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.51 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|