C25H19N3O7 — CID 10790657
3-[(2R,3R,4S,5S)-3,4,5-trihydroxyoxan-2-yl]oxy-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4,6,8,10,15,17,19,21-nonaene-12,14-dione (PubChem CID 10790657) has the molecular formula C25H19N3O7 and a molecular weight of 473.44 g/mol. Its IUPAC name is 3-[(2R,3R,4S,5S)-3,4,5-trihydroxyoxan-2-yl]oxy-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4,6,8,10,15,17,19,21-nonaene-12,14-dione.
| Compound Name | 3-[(2R,3R,4S,5S)-3,4,5-trihydroxyoxan-2-yl]oxy-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4,6,8,10,15,17,19,21-nonaene-12,14-dione |
|---|---|
| PubChem CID | 10790657 |
| Molecular Formula | C25H19N3O7 |
| Molecular Weight | 473.44 g/mol |
| Exact Mass | 473.12 |
| IUPAC Name | 3-[(2R,3R,4S,5S)-3,4,5-trihydroxyoxan-2-yl]oxy-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4,6,8,10,15,17,19,21-nonaene-12,14-dione |
| SMILES | O=C1NC(=O)c2c1c1c3ccccc3[nH]c1c1c2c2ccccc2n1O[C@H]1OCC(O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C25H19N3O7/c29-14-9-34-25(22(31)21(14)30)35-28-13-8-4-2-6-11(13)16-18-17(23(32)27-24(18)33)15-10-5-1-3-7-12(10)26-19(15)20(16)28/h1-8,14,21-22,25-26,29-31H,9H2,(H,27,32,33)/t14?,21-,22+,25+/m0/s1 |
| InChIKey | IPJSOXNKOXIEON-JGQXZDMMSA-N |
| XLogP | 1.18 |
| TPSA | 146.04 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.44 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|