C25H16ClN3O3 — CID 58936699
6-chloro-3-[(4S)-4-hydroxycyclopent-2-en-1-yl]-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4(9),5,7,10,15,17,19,21-nonaene-12,14-dione (PubChem CID 58936699) has the molecular formula C25H16ClN3O3 and a molecular weight of 441.87 g/mol. Its IUPAC name is 6-chloro-3-[(4S)-4-hydroxycyclopent-2-en-1-yl]-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4(9),5,7,10,15,17,19,21-nonaene-12,14-dione.
| Compound Name | 6-chloro-3-[(4S)-4-hydroxycyclopent-2-en-1-yl]-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4(9),5,7,10,15,17,19,21-nonaene-12,14-dione |
|---|---|
| PubChem CID | 58936699 |
| Molecular Formula | C25H16ClN3O3 |
| Molecular Weight | 441.87 g/mol |
| Exact Mass | 441.09 |
| IUPAC Name | 6-chloro-3-[(4S)-4-hydroxycyclopent-2-en-1-yl]-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4(9),5,7,10,15,17,19,21-nonaene-12,14-dione |
| SMILES | O=C1NC(=O)c2c1c1c3ccccc3[nH]c1c1c2c2ccc(Cl)cc2n1C1C=C[C@@H](O)C1 |
| InChI | InChI=1S/C25H16ClN3O3/c26-11-5-8-15-17(9-11)29(12-6-7-13(30)10-12)23-19(15)21-20(24(31)28-25(21)32)18-14-3-1-2-4-16(14)27-22(18)23/h1-9,12-13,27,30H,10H2,(H,28,31,32)/t12?,13-/m1/s1 |
| InChIKey | MWMGHWNJUKVWLA-ZGTCLIOFSA-N |
| XLogP | 4.83 |
| TPSA | 87.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.87 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|