C32H26N4O5 — CID 102245463
tert-butyl 13-methyl-12,14-dioxo-20-phenylmethoxy-3,5,13,23-tetrazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4(9),5,7,10,15,17(22),18,20-nonaene-23-carboxylate (PubChem CID 102245463) has the molecular formula C32H26N4O5 and a molecular weight of 546.58 g/mol. Its IUPAC name is tert-butyl 13-methyl-12,14-dioxo-20-phenylmethoxy-3,5,13,23-tetrazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4(9),5,7,10,15,17(22),18,20-nonaene-23-carboxylate.
| Compound Name | tert-butyl 13-methyl-12,14-dioxo-20-phenylmethoxy-3,5,13,23-tetrazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4(9),5,7,10,15,17(22),18,20-nonaene-23-carboxylate |
|---|---|
| PubChem CID | 102245463 |
| Molecular Formula | C32H26N4O5 |
| Molecular Weight | 546.58 g/mol |
| Exact Mass | 546.19 |
| IUPAC Name | tert-butyl 13-methyl-12,14-dioxo-20-phenylmethoxy-3,5,13,23-tetrazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4(9),5,7,10,15,17(22),18,20-nonaene-23-carboxylate |
| SMILES | CN1C(=O)c2c(c3c4ccc(OCc5ccccc5)cc4n(C(=O)OC(C)(C)C)c3c3[nH]c4ncccc4c23)C1=O |
| InChI | InChI=1S/C32H26N4O5/c1-32(2,3)41-31(39)36-21-15-18(40-16-17-9-6-5-7-10-17)12-13-19(21)23-25-24(29(37)35(4)30(25)38)22-20-11-8-14-33-28(20)34-26(22)27(23)36/h5-15H,16H2,1-4H3,(H,33,34) |
| InChIKey | PDEWTWYNXSDHBB-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 106.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.58 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|