C26H21N3O4 — CID 101161061
tert-butyl 13-methyl-12,14-dioxo-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4,6,8,10,15,17,19,21-nonaene-3-carboxylate (PubChem CID 101161061) has the molecular formula C26H21N3O4 and a molecular weight of 439.47 g/mol. Its IUPAC name is tert-butyl 13-methyl-12,14-dioxo-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4,6,8,10,15,17,19,21-nonaene-3-carboxylate.
| Compound Name | tert-butyl 13-methyl-12,14-dioxo-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4,6,8,10,15,17,19,21-nonaene-3-carboxylate |
|---|---|
| PubChem CID | 101161061 |
| Molecular Formula | C26H21N3O4 |
| Molecular Weight | 439.47 g/mol |
| Exact Mass | 439.15 |
| IUPAC Name | tert-butyl 13-methyl-12,14-dioxo-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4,6,8,10,15,17,19,21-nonaene-3-carboxylate |
| SMILES | CN1C(=O)c2c(c3c4ccccc4n(C(=O)OC(C)(C)C)c3c3[nH]c4ccccc4c23)C1=O |
| InChI | InChI=1S/C26H21N3O4/c1-26(2,3)33-25(32)29-16-12-8-6-10-14(16)18-20-19(23(30)28(4)24(20)31)17-13-9-5-7-11-15(13)27-21(17)22(18)29/h5-12,27H,1-4H3 |
| InChIKey | IXFODEYWQNQZKK-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 84.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.47 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|